C23H31N5O3 — CID 121255921
tert-butyl N-[2-[[2-(3-methylbutyl)-6-(1,3-oxazol-5-yl)quinazolin-4-yl]amino]ethyl]carbamate (PubChem CID 121255921) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(3-methylbutyl)-6-(1,3-oxazol-5-yl)quinazolin-4-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(3-methylbutyl)-6-(1,3-oxazol-5-yl)quinazolin-4-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 121255921 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | tert-butyl N-[2-[[2-(3-methylbutyl)-6-(1,3-oxazol-5-yl)quinazolin-4-yl]amino]ethyl]carbamate |
| SMILES | CC(C)CCc1nc(NCCNC(=O)OC(C)(C)C)c2cc(-c3cnco3)ccc2n1 |
| InChI | InChI=1S/C23H31N5O3/c1-15(2)6-9-20-27-18-8-7-16(19-13-24-14-30-19)12-17(18)21(28-20)25-10-11-26-22(29)31-23(3,4)5/h7-8,12-15H,6,9-11H2,1-5H3,(H,26,29)(H,25,27,28) |
| InChIKey | IZWCUZYZWGDSQZ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|