C15H21FN6O2 — CID 166859864
tert-butyl N-[2-[[3-fluoro-6-(1-methyl-1,2,4-triazol-3-yl)-2-pyridinyl]amino]ethyl]carbamate (PubChem CID 166859864) has the molecular formula C15H21FN6O2 and a molecular weight of 336.37 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-fluoro-6-(1-methyl-1,2,4-triazol-3-yl)-2-pyridinyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-fluoro-6-(1-methyl-1,2,4-triazol-3-yl)-2-pyridinyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 166859864 |
| Molecular Formula | C15H21FN6O2 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | tert-butyl N-[2-[[3-fluoro-6-(1-methyl-1,2,4-triazol-3-yl)-2-pyridinyl]amino]ethyl]carbamate |
| SMILES | Cn1cnc(-c2ccc(F)c(NCCNC(=O)OC(C)(C)C)n2)n1 |
| InChI | InChI=1S/C15H21FN6O2/c1-15(2,3)24-14(23)18-8-7-17-12-10(16)5-6-11(20-12)13-19-9-22(4)21-13/h5-6,9H,7-8H2,1-4H3,(H,17,20)(H,18,23) |
| InChIKey | INNCHTHUIJKSNG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|