C18H17N3O3 — CID 75403914
2-[4-[[3-(1,3-oxazol-5-yl)anilino]methyl]phenoxy]acetamide (PubChem CID 75403914) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[4-[[3-(1,3-oxazol-5-yl)anilino]methyl]phenoxy]acetamide.
| Compound Name | 2-[4-[[3-(1,3-oxazol-5-yl)anilino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 75403914 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[4-[[3-(1,3-oxazol-5-yl)anilino]methyl]phenoxy]acetamide |
| SMILES | NC(=O)COc1ccc(CNc2cccc(-c3cnco3)c2)cc1 |
| InChI | InChI=1S/C18H17N3O3/c19-18(22)11-23-16-6-4-13(5-7-16)9-21-15-3-1-2-14(8-15)17-10-20-12-24-17/h1-8,10,12,21H,9,11H2,(H2,19,22) |
| InChIKey | PZLDYGUSYJBBRU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |