C16H11F3N2O4S — CID 3796264
N-[3-(1,3-oxazol-5-yl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 3796264) has the molecular formula C16H11F3N2O4S and a molecular weight of 384.34 g/mol. Its IUPAC name is N-[3-(1,3-oxazol-5-yl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[3-(1,3-oxazol-5-yl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 3796264 |
| Molecular Formula | C16H11F3N2O4S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | N-[3-(1,3-oxazol-5-yl)phenyl]-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2cnco2)c1)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C16H11F3N2O4S/c17-16(18,19)25-13-6-1-2-7-15(13)26(22,23)21-12-5-3-4-11(8-12)14-9-20-10-24-14/h1-10,21H |
| InChIKey | XYQGRUVTKAPAOR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |