C21H34O4Si2 — CID 11575039
ethyl (1R,5R)-5-(hydroxymethyl)-7,7-bis(2-trimethylsilylethynyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 11575039) has the molecular formula C21H34O4Si2 and a molecular weight of 406.67 g/mol. Its IUPAC name is ethyl (1R,5R)-5-(hydroxymethyl)-7,7-bis(2-trimethylsilylethynyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | ethyl (1R,5R)-5-(hydroxymethyl)-7,7-bis(2-trimethylsilylethynyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 11575039 |
| Molecular Formula | C21H34O4Si2 |
| Molecular Weight | 406.67 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | ethyl (1R,5R)-5-(hydroxymethyl)-7,7-bis(2-trimethylsilylethynyl)-6-oxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | CCOC(=O)[C@]12CCC[C@](CO)(C1)OC2(C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C21H34O4Si2/c1-8-24-18(23)20-11-9-10-19(16-20,17-22)25-21(20,12-14-26(2,3)4)13-15-27(5,6)7/h22H,8-11,16-17H2,1-7H3/t19-,20+/m1/s1 |
| InChIKey | VFNMHGHJZGHRLA-UXHICEINSA-N |
| XLogP | 3.37 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.67 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|