C12H20O3Si — CID 123597559
ethyl 1-(hydroxymethyl)-2-(2-trimethylsilylethynyl)cyclopropane-1-carboxylate (PubChem CID 123597559) has the molecular formula C12H20O3Si and a molecular weight of 240.37 g/mol. Its IUPAC name is ethyl 1-(hydroxymethyl)-2-(2-trimethylsilylethynyl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-(hydroxymethyl)-2-(2-trimethylsilylethynyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 123597559 |
| Molecular Formula | C12H20O3Si |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | ethyl 1-(hydroxymethyl)-2-(2-trimethylsilylethynyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(CO)CC1C#C[Si](C)(C)C |
| InChI | InChI=1S/C12H20O3Si/c1-5-15-11(14)12(9-13)8-10(12)6-7-16(2,3)4/h10,13H,5,8-9H2,1-4H3 |
| InChIKey | XHEPFPJKRZSNHF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|