C20H17N3O5S — CID 11575138
3-(carbamoylamino)-6-(2-phenoxyethoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide (PubChem CID 11575138) has the molecular formula C20H17N3O5S and a molecular weight of 411.44 g/mol. Its IUPAC name is 3-(carbamoylamino)-6-(2-phenoxyethoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide.
| Compound Name | 3-(carbamoylamino)-6-(2-phenoxyethoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide |
|---|---|
| PubChem CID | 11575138 |
| Molecular Formula | C20H17N3O5S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 3-(carbamoylamino)-6-(2-phenoxyethoxy)-[1]benzothiolo[3,2-b]furan-2-carboxamide |
| SMILES | NC(=O)Nc1c(C(N)=O)oc2c1sc1cc(OCCOc3ccccc3)ccc12 |
| InChI | InChI=1S/C20H17N3O5S/c21-19(24)17-15(23-20(22)25)18-16(28-17)13-7-6-12(10-14(13)29-18)27-9-8-26-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H2,21,24)(H3,22,23,25) |
| InChIKey | JETGGYDNRSYOLY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|