C19H23N3O5S — CID 16656293
tert-butyl N-[3-[(3-amino-2-carbamoyl-[1]benzothiolo[3,2-b]furan-6-yl)oxy]propyl]carbamate (PubChem CID 16656293) has the molecular formula C19H23N3O5S and a molecular weight of 405.48 g/mol. Its IUPAC name is tert-butyl N-[3-[(3-amino-2-carbamoyl-[1]benzothiolo[3,2-b]furan-6-yl)oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3-amino-2-carbamoyl-[1]benzothiolo[3,2-b]furan-6-yl)oxy]propyl]carbamate |
|---|---|
| PubChem CID | 16656293 |
| Molecular Formula | C19H23N3O5S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | tert-butyl N-[3-[(3-amino-2-carbamoyl-[1]benzothiolo[3,2-b]furan-6-yl)oxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc2c(c1)sc1c(N)c(C(N)=O)oc12 |
| InChI | InChI=1S/C19H23N3O5S/c1-19(2,3)27-18(24)22-7-4-8-25-10-5-6-11-12(9-10)28-16-13(20)15(17(21)23)26-14(11)16/h5-6,9H,4,7-8,20H2,1-3H3,(H2,21,23)(H,22,24) |
| InChIKey | GHZOCPZNVVCNDV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 129.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|