C20H24N4O6S — CID 143207879
tert-butyl N-[3-[[2-carbamoyl-3-(carbamoylamino)-[1]benzothiolo[3,2-b]furan-7-yl]oxy]propyl]carbamate (PubChem CID 143207879) has the molecular formula C20H24N4O6S and a molecular weight of 448.50 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-carbamoyl-3-(carbamoylamino)-[1]benzothiolo[3,2-b]furan-7-yl]oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-carbamoyl-3-(carbamoylamino)-[1]benzothiolo[3,2-b]furan-7-yl]oxy]propyl]carbamate |
|---|---|
| PubChem CID | 143207879 |
| Molecular Formula | C20H24N4O6S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | tert-butyl N-[3-[[2-carbamoyl-3-(carbamoylamino)-[1]benzothiolo[3,2-b]furan-7-yl]oxy]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCOc1ccc2sc3c(NC(N)=O)c(C(N)=O)oc3c2c1 |
| InChI | InChI=1S/C20H24N4O6S/c1-20(2,3)30-19(27)23-7-4-8-28-10-5-6-12-11(9-10)14-16(31-12)13(24-18(22)26)15(29-14)17(21)25/h5-6,9H,4,7-8H2,1-3H3,(H2,21,25)(H,23,27)(H3,22,24,26) |
| InChIKey | NFQKONUMMNOGSP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|