C13H19NO5S — CID 115754601
N-(2-hydroxyethyl)-2,5-dimethoxy-N-prop-2-enylbenzenesulfonamide (PubChem CID 115754601) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2,5-dimethoxy-N-prop-2-enylbenzenesulfonamide.
| Compound Name | N-(2-hydroxyethyl)-2,5-dimethoxy-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 115754601 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-(2-hydroxyethyl)-2,5-dimethoxy-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN(CCO)S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H19NO5S/c1-4-7-14(8-9-15)20(16,17)13-10-11(18-2)5-6-12(13)19-3/h4-6,10,15H,1,7-9H2,2-3H3 |
| InChIKey | MIBHOTNSFAUNRY-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|