C11H14N2S — CID 115765554
N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-2-amine (PubChem CID 115765554) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-2-amine.
| Compound Name | N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 115765554 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | N-(thieno[3,2-b]pyridin-6-ylmethyl)propan-2-amine |
| SMILES | CC(C)NCc1cnc2ccsc2c1 |
| InChI | InChI=1S/C11H14N2S/c1-8(2)12-6-9-5-11-10(13-7-9)3-4-14-11/h3-5,7-8,12H,6H2,1-2H3 |
| InChIKey | DBAGTHXZFYRTMJ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |