C10H13N3O2S — CID 115774710
2-[(5-cyanothiophen-2-yl)methylamino]-3-methoxypropanamide (PubChem CID 115774710) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-[(5-cyanothiophen-2-yl)methylamino]-3-methoxypropanamide.
| Compound Name | 2-[(5-cyanothiophen-2-yl)methylamino]-3-methoxypropanamide |
|---|---|
| PubChem CID | 115774710 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 2-[(5-cyanothiophen-2-yl)methylamino]-3-methoxypropanamide |
| SMILES | COCC(NCc1ccc(C#N)s1)C(N)=O |
| InChI | InChI=1S/C10H13N3O2S/c1-15-6-9(10(12)14)13-5-8-3-2-7(4-11)16-8/h2-3,9,13H,5-6H2,1H3,(H2,12,14) |
| InChIKey | SMEGPINZSWQANY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |