C11H20O3S — CID 115802354
2-cyclobutyl-1-(1,1-dioxothian-2-yl)ethanol (PubChem CID 115802354) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 2-cyclobutyl-1-(1,1-dioxothian-2-yl)ethanol.
| Compound Name | 2-cyclobutyl-1-(1,1-dioxothian-2-yl)ethanol |
|---|---|
| PubChem CID | 115802354 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-cyclobutyl-1-(1,1-dioxothian-2-yl)ethanol |
| SMILES | O=S1(=O)CCCCC1C(O)CC1CCC1 |
| InChI | InChI=1S/C11H20O3S/c12-10(8-9-4-3-5-9)11-6-1-2-7-15(11,13)14/h9-12H,1-8H2 |
| InChIKey | TVVZAGXKRWXZNQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |