C14H20O4S — CID 115803705
1-(1,3-dihydro-2-benzofuran-5-yl)-4-ethylsulfonylbutan-1-ol (PubChem CID 115803705) has the molecular formula C14H20O4S and a molecular weight of 284.38 g/mol. Its IUPAC name is 1-(1,3-dihydro-2-benzofuran-5-yl)-4-ethylsulfonylbutan-1-ol.
| Compound Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-4-ethylsulfonylbutan-1-ol |
|---|---|
| PubChem CID | 115803705 |
| Molecular Formula | C14H20O4S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-(1,3-dihydro-2-benzofuran-5-yl)-4-ethylsulfonylbutan-1-ol |
| SMILES | CCS(=O)(=O)CCCC(O)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C14H20O4S/c1-2-19(16,17)7-3-4-14(15)11-5-6-12-9-18-10-13(12)8-11/h5-6,8,14-15H,2-4,7,9-10H2,1H3 |
| InChIKey | TXHULJGQRLLDKG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |