C15H17ClF2O2 — CID 115814122
(4-chloro-2,5-difluorophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone (PubChem CID 115814122) has the molecular formula C15H17ClF2O2 and a molecular weight of 302.75 g/mol. Its IUPAC name is (4-chloro-2,5-difluorophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone.
| Compound Name | (4-chloro-2,5-difluorophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 115814122 |
| Molecular Formula | C15H17ClF2O2 |
| Molecular Weight | 302.75 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (4-chloro-2,5-difluorophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone |
| SMILES | CC1(C)CC(C(=O)c2cc(F)c(Cl)cc2F)C(C)(C)O1 |
| InChI | InChI=1S/C15H17ClF2O2/c1-14(2)7-9(15(3,4)20-14)13(19)8-5-12(18)10(16)6-11(8)17/h5-6,9H,7H2,1-4H3 |
| InChIKey | HODAJRFFFIHZLU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.75 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|