C15H19Cl2N — CID 115830720
1-(7-bicyclo[4.1.0]heptanyl)-2-(2,6-dichlorophenyl)ethanamine (PubChem CID 115830720) has the molecular formula C15H19Cl2N and a molecular weight of 284.23 g/mol. Its IUPAC name is 1-(7-bicyclo[4.1.0]heptanyl)-2-(2,6-dichlorophenyl)ethanamine.
| Compound Name | 1-(7-bicyclo[4.1.0]heptanyl)-2-(2,6-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 115830720 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 1-(7-bicyclo[4.1.0]heptanyl)-2-(2,6-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1c(Cl)cccc1Cl)C1C2CCCCC21 |
| InChI | InChI=1S/C15H19Cl2N/c16-12-6-3-7-13(17)11(12)8-14(18)15-9-4-1-2-5-10(9)15/h3,6-7,9-10,14-15H,1-2,4-5,8,18H2 |
| InChIKey | IIHBQEODIXDRCQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |