C14H17Cl2N — CID 115830174
1-(6-bicyclo[3.1.0]hexanyl)-2-(2,6-dichlorophenyl)ethanamine (PubChem CID 115830174) has the molecular formula C14H17Cl2N and a molecular weight of 270.20 g/mol. Its IUPAC name is 1-(6-bicyclo[3.1.0]hexanyl)-2-(2,6-dichlorophenyl)ethanamine.
| Compound Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(2,6-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 115830174 |
| Molecular Formula | C14H17Cl2N |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 1-(6-bicyclo[3.1.0]hexanyl)-2-(2,6-dichlorophenyl)ethanamine |
| SMILES | NC(Cc1c(Cl)cccc1Cl)C1C2CCCC21 |
| InChI | InChI=1S/C14H17Cl2N/c15-11-5-2-6-12(16)10(11)7-13(17)14-8-3-1-4-9(8)14/h2,5-6,8-9,13-14H,1,3-4,7,17H2 |
| InChIKey | IHINVGOYEOFEJK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |