C14H24BrNS — CID 115847608
1-(4-bromothiophen-2-yl)-N-methyl-3-propylhexan-2-amine (PubChem CID 115847608) has the molecular formula C14H24BrNS and a molecular weight of 318.32 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-N-methyl-3-propylhexan-2-amine.
| Compound Name | 1-(4-bromothiophen-2-yl)-N-methyl-3-propylhexan-2-amine |
|---|---|
| PubChem CID | 115847608 |
| Molecular Formula | C14H24BrNS |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-N-methyl-3-propylhexan-2-amine |
| SMILES | CCCC(CCC)C(Cc1cc(Br)cs1)NC |
| InChI | InChI=1S/C14H24BrNS/c1-4-6-11(7-5-2)14(16-3)9-13-8-12(15)10-17-13/h8,10-11,14,16H,4-7,9H2,1-3H3 |
| InChIKey | CHQAPFKURRNACB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |