C15H18NO5P — CID 11585907
[(E)-4-(6-methoxynaphthalen-2-yl)butan-2-ylideneamino] dihydrogen phosphate (PubChem CID 11585907) has the molecular formula C15H18NO5P and a molecular weight of 323.29 g/mol. Its IUPAC name is [(E)-4-(6-methoxynaphthalen-2-yl)butan-2-ylideneamino] dihydrogen phosphate.
| Compound Name | [(E)-4-(6-methoxynaphthalen-2-yl)butan-2-ylideneamino] dihydrogen phosphate |
|---|---|
| PubChem CID | 11585907 |
| Molecular Formula | C15H18NO5P |
| Molecular Weight | 323.29 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [(E)-4-(6-methoxynaphthalen-2-yl)butan-2-ylideneamino] dihydrogen phosphate |
| SMILES | COc1ccc2cc(CC/C(C)=N/OP(=O)(O)O)ccc2c1 |
| InChI | InChI=1S/C15H18NO5P/c1-11(16-21-22(17,18)19)3-4-12-5-6-14-10-15(20-2)8-7-13(14)9-12/h5-10H,3-4H2,1-2H3,(H2,17,18,19)/b16-11+ |
| InChIKey | GNQUZYLWKZUFMR-LFIBNONCSA-N |
| XLogP | 3.27 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|