C15H18F2N2O2 — CID 115871509
1-cyclopropyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-methylpyrrolidin-3-amine (PubChem CID 115871509) has the molecular formula C15H18F2N2O2 and a molecular weight of 296.32 g/mol. Its IUPAC name is 1-cyclopropyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-methylpyrrolidin-3-amine.
| Compound Name | 1-cyclopropyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115871509 |
| Molecular Formula | C15H18F2N2O2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-cyclopropyl-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-5-methylpyrrolidin-3-amine |
| SMILES | CC1CC(Nc2ccc3c(c2)OC(F)(F)O3)CN1C1CC1 |
| InChI | InChI=1S/C15H18F2N2O2/c1-9-6-11(8-19(9)12-3-4-12)18-10-2-5-13-14(7-10)21-15(16,17)20-13/h2,5,7,9,11-12,18H,3-4,6,8H2,1H3 |
| InChIKey | CVIHXRYJTUDQFN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|