C12H17BrFN — CID 115876821
2-(3-bromophenyl)-N-(3-fluoropropyl)propan-1-amine (PubChem CID 115876821) has the molecular formula C12H17BrFN and a molecular weight of 274.18 g/mol. Its IUPAC name is 2-(3-bromophenyl)-N-(3-fluoropropyl)propan-1-amine.
| Compound Name | 2-(3-bromophenyl)-N-(3-fluoropropyl)propan-1-amine |
|---|---|
| PubChem CID | 115876821 |
| Molecular Formula | C12H17BrFN |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-(3-bromophenyl)-N-(3-fluoropropyl)propan-1-amine |
| SMILES | CC(CNCCCF)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H17BrFN/c1-10(9-15-7-3-6-14)11-4-2-5-12(13)8-11/h2,4-5,8,10,15H,3,6-7,9H2,1H3 |
| InChIKey | SEVOCMJJDUYHIN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|