C16H22BrNO3 — CID 115880854
3-bromo-N-(3,3-dimethylcyclopentyl)-2,5-dimethoxybenzamide (PubChem CID 115880854) has the molecular formula C16H22BrNO3 and a molecular weight of 356.26 g/mol. Its IUPAC name is 3-bromo-N-(3,3-dimethylcyclopentyl)-2,5-dimethoxybenzamide.
| Compound Name | 3-bromo-N-(3,3-dimethylcyclopentyl)-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 115880854 |
| Molecular Formula | C16H22BrNO3 |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 3-bromo-N-(3,3-dimethylcyclopentyl)-2,5-dimethoxybenzamide |
| SMILES | COc1cc(Br)c(OC)c(C(=O)NC2CCC(C)(C)C2)c1 |
| InChI | InChI=1S/C16H22BrNO3/c1-16(2)6-5-10(9-16)18-15(19)12-7-11(20-3)8-13(17)14(12)21-4/h7-8,10H,5-6,9H2,1-4H3,(H,18,19) |
| InChIKey | NUUKAYVVNCNJLB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |