C13H18N2S — CID 115887879
N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethyl)cyclohex-2-en-1-amine (PubChem CID 115887879) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethyl)cyclohex-2-en-1-amine.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethyl)cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 115887879 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethyl)cyclohex-2-en-1-amine |
| SMILES | C1=CC(NCc2nc3c(s2)CCC3)CCC1 |
| InChI | InChI=1S/C13H18N2S/c1-2-5-10(6-3-1)14-9-13-15-11-7-4-8-12(11)16-13/h2,5,10,14H,1,3-4,6-9H2 |
| InChIKey | VNAYEGUBCTXVMP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|