C10H15FN2S — CID 115887949
N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethyl)-3-fluoropropan-1-amine (PubChem CID 115887949) has the molecular formula C10H15FN2S and a molecular weight of 214.31 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethyl)-3-fluoropropan-1-amine.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethyl)-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 115887949 |
| Molecular Formula | C10H15FN2S |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-ylmethyl)-3-fluoropropan-1-amine |
| SMILES | FCCCNCc1nc2c(s1)CCC2 |
| InChI | InChI=1S/C10H15FN2S/c11-5-2-6-12-7-10-13-8-3-1-4-9(8)14-10/h12H,1-7H2 |
| InChIKey | WLJHLJYSSRARQQ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|