C24H30O3S — CID 11589375
3-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one (PubChem CID 11589375) has the molecular formula C24H30O3S and a molecular weight of 398.57 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one.
| Compound Name | 3-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
|---|---|
| PubChem CID | 11589375 |
| Molecular Formula | C24H30O3S |
| Molecular Weight | 398.57 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 3-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]-1-[(2S,4R)-3,3,9-trimethyl-8-thiatricyclo[4.3.0.02,4]nona-1(9),6-dien-7-yl]propan-1-one |
| SMILES | Cc1cc(CCC(=O)c2sc(C)c3c2C[C@@H]2[C@H]3C2(C)C)cc(C)c1OCCO |
| InChI | InChI=1S/C24H30O3S/c1-13-10-16(11-14(2)22(13)27-9-8-25)6-7-19(26)23-17-12-18-21(24(18,4)5)20(17)15(3)28-23/h10-11,18,21,25H,6-9,12H2,1-5H3/t18-,21-/m1/s1 |
| InChIKey | WUTQUIJLYBEKGV-WIYYLYMNSA-N |
| XLogP | 5.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |