C13H20N2S — CID 115893761
N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]hex-5-yn-1-amine (PubChem CID 115893761) has the molecular formula C13H20N2S and a molecular weight of 236.38 g/mol. Its IUPAC name is N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]hex-5-yn-1-amine.
| Compound Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]hex-5-yn-1-amine |
|---|---|
| PubChem CID | 115893761 |
| Molecular Formula | C13H20N2S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-[1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]hex-5-yn-1-amine |
| SMILES | C#CCCCCNC(C)c1nc(C)sc1C |
| InChI | InChI=1S/C13H20N2S/c1-5-6-7-8-9-14-10(2)13-11(3)16-12(4)15-13/h1,10,14H,6-9H2,2-4H3 |
| InChIKey | JWJPRTWQSNMKQP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|