C12H28N2O2 — CID 115895816
1-(dimethylamino)-3-[(1-methoxy-3-methylbutan-2-yl)amino]-2-methylpropan-2-ol (PubChem CID 115895816) has the molecular formula C12H28N2O2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[(1-methoxy-3-methylbutan-2-yl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[(1-methoxy-3-methylbutan-2-yl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 115895816 |
| Molecular Formula | C12H28N2O2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1-(dimethylamino)-3-[(1-methoxy-3-methylbutan-2-yl)amino]-2-methylpropan-2-ol |
| SMILES | COCC(NCC(C)(O)CN(C)C)C(C)C |
| InChI | InChI=1S/C12H28N2O2/c1-10(2)11(7-16-6)13-8-12(3,15)9-14(4)5/h10-11,13,15H,7-9H2,1-6H3 |
| InChIKey | SUAPXUWWOOZCEZ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |