C14H17NO — CID 115896851
N-but-2-ynyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine (PubChem CID 115896851) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-but-2-ynyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine.
| Compound Name | N-but-2-ynyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
|---|---|
| PubChem CID | 115896851 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-but-2-ynyl-2,3,4,5-tetrahydro-1-benzoxepin-5-amine |
| SMILES | CC#CCNC1CCCOc2ccccc21 |
| InChI | InChI=1S/C14H17NO/c1-2-3-10-15-13-8-6-11-16-14-9-5-4-7-12(13)14/h4-5,7,9,13,15H,6,8,10-11H2,1H3 |
| InChIKey | NVLOSCNFZFOFQE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|