C11H16BrNO3 — CID 115907842
2-[(5-bromo-2-hydroxy-3-methylphenyl)methylamino]propane-1,3-diol (PubChem CID 115907842) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is 2-[(5-bromo-2-hydroxy-3-methylphenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(5-bromo-2-hydroxy-3-methylphenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 115907842 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 2-[(5-bromo-2-hydroxy-3-methylphenyl)methylamino]propane-1,3-diol |
| SMILES | Cc1cc(Br)cc(CNC(CO)CO)c1O |
| InChI | InChI=1S/C11H16BrNO3/c1-7-2-9(12)3-8(11(7)16)4-13-10(5-14)6-15/h2-3,10,13-16H,4-6H2,1H3 |
| InChIKey | BBNRYRCAOZRHHW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|