C28H33Cl3N4O2 — CID 11592180
[3-amino-5-[[4-[4-[bis(2-chloroethyl)amino]butoxy]acridin-9-yl]amino]phenyl]methanol;hydrochloride (PubChem CID 11592180) has the molecular formula C28H33Cl3N4O2 and a molecular weight of 563.96 g/mol. Its IUPAC name is [3-amino-5-[[4-[4-[bis(2-chloroethyl)amino]butoxy]acridin-9-yl]amino]phenyl]methanol;hydrochloride.
| Compound Name | [3-amino-5-[[4-[4-[bis(2-chloroethyl)amino]butoxy]acridin-9-yl]amino]phenyl]methanol;hydrochloride |
|---|---|
| PubChem CID | 11592180 |
| Molecular Formula | C28H33Cl3N4O2 |
| Molecular Weight | 563.96 g/mol |
| Exact Mass | 562.17 |
| IUPAC Name | [3-amino-5-[[4-[4-[bis(2-chloroethyl)amino]butoxy]acridin-9-yl]amino]phenyl]methanol;hydrochloride |
| SMILES | Cl.Nc1cc(CO)cc(Nc2c3ccccc3nc3c(OCCCCN(CCCl)CCCl)cccc23)c1 |
| InChI | InChI=1S/C28H32Cl2N4O2.ClH/c29-10-13-34(14-11-30)12-3-4-15-36-26-9-5-7-24-27(23-6-1-2-8-25(23)33-28(24)26)32-22-17-20(19-35)16-21(31)18-22;/h1-2,5-9,16-18,35H,3-4,10-15,19,31H2,(H,32,33);1H |
| InChIKey | CUHXCSHNZVVUAW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 83.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.96 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|