C28H27Cl4N3O — CID 21144145
4-(benzo[c]acridin-7-ylamino)-2-[bis(2-chloroethyl)aminomethyl]phenol;dihydrochloride (PubChem CID 21144145) has the molecular formula C28H27Cl4N3O and a molecular weight of 563.36 g/mol. Its IUPAC name is 4-(benzo[c]acridin-7-ylamino)-2-[bis(2-chloroethyl)aminomethyl]phenol;dihydrochloride.
| Compound Name | 4-(benzo[c]acridin-7-ylamino)-2-[bis(2-chloroethyl)aminomethyl]phenol;dihydrochloride |
|---|---|
| PubChem CID | 21144145 |
| Molecular Formula | C28H27Cl4N3O |
| Molecular Weight | 563.36 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 4-(benzo[c]acridin-7-ylamino)-2-[bis(2-chloroethyl)aminomethyl]phenol;dihydrochloride |
| SMILES | Cl.Cl.Oc1ccc(Nc2c3ccccc3nc3c2ccc2ccccc23)cc1CN(CCCl)CCCl |
| InChI | InChI=1S/C28H25Cl2N3O.2ClH/c29-13-15-33(16-14-30)18-20-17-21(10-12-26(20)34)31-28-23-7-3-4-8-25(23)32-27-22-6-2-1-5-19(22)9-11-24(27)28;;/h1-12,17,34H,13-16,18H2,(H,31,32);2*1H |
| InChIKey | UESTVZXEKGSKTO-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.36 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|