C13H17F3N2O3 — CID 115942033
2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 115942033) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 115942033 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CC(C)(C)OCCOc1nc(C(F)(F)F)ccc1C(N)=O |
| InChI | InChI=1S/C13H17F3N2O3/c1-12(2,3)21-7-6-20-11-8(10(17)19)4-5-9(18-11)13(14,15)16/h4-5H,6-7H2,1-3H3,(H2,17,19) |
| InChIKey | YBCIDNZCARMYGT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|