C13H16F3NO4S — CID 167783025
1-[2-(3-ethylsulfonylpropoxy)-6-(trifluoromethyl)-3-pyridinyl]ethanone (PubChem CID 167783025) has the molecular formula C13H16F3NO4S and a molecular weight of 339.34 g/mol. Its IUPAC name is 1-[2-(3-ethylsulfonylpropoxy)-6-(trifluoromethyl)-3-pyridinyl]ethanone.
| Compound Name | 1-[2-(3-ethylsulfonylpropoxy)-6-(trifluoromethyl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 167783025 |
| Molecular Formula | C13H16F3NO4S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 1-[2-(3-ethylsulfonylpropoxy)-6-(trifluoromethyl)-3-pyridinyl]ethanone |
| SMILES | CCS(=O)(=O)CCCOc1nc(C(F)(F)F)ccc1C(C)=O |
| InChI | InChI=1S/C13H16F3NO4S/c1-3-22(19,20)8-4-7-21-12-10(9(2)18)5-6-11(17-12)13(14,15)16/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | HYNQRBBJJWHMIB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|