C14H20N4S — CID 11594284
1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-(3-imidazol-1-ylpropyl)thiourea (PubChem CID 11594284) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-(3-imidazol-1-ylpropyl)thiourea.
| Compound Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-(3-imidazol-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 11594284 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-3-(3-imidazol-1-ylpropyl)thiourea |
| SMILES | S=C(NCCCn1ccnc1)N[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C14H20N4S/c19-14(16-4-1-6-18-7-5-15-10-18)17-13-9-11-2-3-12(13)8-11/h2-3,5,7,10-13H,1,4,6,8-9H2,(H2,16,17,19)/t11-,12+,13-/m1/s1 |
| InChIKey | YRTUVRXYHYOAEP-FRRDWIJNSA-N |
| XLogP | 1.70 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|