About 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone
1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone (PubChem CID 115964101) has the molecular formula C14H14N2O3S2
and a molecular weight of 322.41 g/mol. Its IUPAC name is 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone |
| PubChem CID | 115964101 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(N2CCc3sccc3C2C)s1 |
| InChI | InChI=1S/C14H14N2O3S2/c1-8-10-4-6-20-12(10)3-5-15(8)14-11(16(18)19)7-13(21-14)9(2)17/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | VSMHUBOTPGSYPS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone?
The IUPAC name of 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone (CID 115964101) is 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone.
What is the SMILES notation for 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone?
The canonical SMILES for 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone is CC(=O)c1cc([N+](=O)[O-])c(N2CCc3sccc3C2C)s1.
What is the InChIKey of 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone?
The InChIKey is VSMHUBOTPGSYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O3S2/c1-8-10-4-6-20-12(10)3-5-15(8)14-11(16(18)19)7-13(21-14)9(2)17/h4,6-8H,3,5H2,1-2H3.
What are the key properties of 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone?
1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone has a molecular weight of 322.41 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-nitrothiophen-2-yl]ethanone is sourced from PubChem (CID 115964101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).