C20H25N3O4S2 — CID 154749489
4-methyl-5-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 154749489) has the molecular formula C20H25N3O4S2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-methyl-5-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 4-methyl-5-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 154749489 |
| Molecular Formula | C20H25N3O4S2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 4-methyl-5-[4-(4-methylpiperidin-1-yl)sulfonyl-2-nitrophenyl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(N3CCc4sccc4C3C)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C20H25N3O4S2/c1-14-5-9-21(10-6-14)29(26,27)16-3-4-18(19(13-16)23(24)25)22-11-7-20-17(15(22)2)8-12-28-20/h3-4,8,12-15H,5-7,9-11H2,1-2H3 |
| InChIKey | QSHKMFXTAADCSK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|