C15H20N2O5S — CID 91650471
tert-butyl (2S)-1-(5-acetyl-3-nitrothiophen-2-yl)pyrrolidine-2-carboxylate (PubChem CID 91650471) has the molecular formula C15H20N2O5S and a molecular weight of 340.40 g/mol. Its IUPAC name is tert-butyl (2S)-1-(5-acetyl-3-nitrothiophen-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-(5-acetyl-3-nitrothiophen-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91650471 |
| Molecular Formula | C15H20N2O5S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | tert-butyl (2S)-1-(5-acetyl-3-nitrothiophen-2-yl)pyrrolidine-2-carboxylate |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(N2CCC[C@H]2C(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C15H20N2O5S/c1-9(18)12-8-11(17(20)21)13(23-12)16-7-5-6-10(16)14(19)22-15(2,3)4/h8,10H,5-7H2,1-4H3/t10-/m0/s1 |
| InChIKey | NUXBJFBGZQQSOT-JTQLQIEISA-N |
| XLogP | 3.17 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|