C13H23N3O5 — CID 115971586
methyl 4-hydroxy-1-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]pyrrolidine-2-carboxylate (PubChem CID 115971586) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 4-hydroxy-1-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 4-hydroxy-1-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 115971586 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | methyl 4-hydroxy-1-[2-(2-methylpropylcarbamoylamino)-2-oxoethyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(O)CN1CC(=O)NC(=O)NCC(C)C |
| InChI | InChI=1S/C13H23N3O5/c1-8(2)5-14-13(20)15-11(18)7-16-6-9(17)4-10(16)12(19)21-3/h8-10,17H,4-7H2,1-3H3,(H2,14,15,18,20) |
| InChIKey | FIJCQUGIGIIPNJ-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |