C13H21N3O2S2 — CID 115985986
3-[2-[methyl(2-methylsulfanylethyl)amino]ethylsulfonyl]benzenecarboximidamide (PubChem CID 115985986) has the molecular formula C13H21N3O2S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 3-[2-[methyl(2-methylsulfanylethyl)amino]ethylsulfonyl]benzenecarboximidamide.
| Compound Name | 3-[2-[methyl(2-methylsulfanylethyl)amino]ethylsulfonyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 115985986 |
| Molecular Formula | C13H21N3O2S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 3-[2-[methyl(2-methylsulfanylethyl)amino]ethylsulfonyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(S(=O)(=O)CCN(C)CCSC)c1 |
| InChI | InChI=1S/C13H21N3O2S2/c1-16(6-8-19-2)7-9-20(17,18)12-5-3-4-11(10-12)13(14)15/h3-5,10H,6-9H2,1-2H3,(H3,14,15) |
| InChIKey | PDGLNYVQKMLNPW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|