C14H19NO — CID 11600978
4-benzyl-3-ethyl-5-methyl-2,3-dihydro-1,4-oxazine (PubChem CID 11600978) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-benzyl-3-ethyl-5-methyl-2,3-dihydro-1,4-oxazine.
| Compound Name | 4-benzyl-3-ethyl-5-methyl-2,3-dihydro-1,4-oxazine |
|---|---|
| PubChem CID | 11600978 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-benzyl-3-ethyl-5-methyl-2,3-dihydro-1,4-oxazine |
| SMILES | CCC1COC=C(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H19NO/c1-3-14-11-16-10-12(2)15(14)9-13-7-5-4-6-8-13/h4-8,10,14H,3,9,11H2,1-2H3 |
| InChIKey | GLVGDIPBJPCUJV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |