C13H17NO — CID 86093974
4-benzyl-3-methyl-6,7-dihydro-5H-1,4-oxazepine (PubChem CID 86093974) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 4-benzyl-3-methyl-6,7-dihydro-5H-1,4-oxazepine.
| Compound Name | 4-benzyl-3-methyl-6,7-dihydro-5H-1,4-oxazepine |
|---|---|
| PubChem CID | 86093974 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-benzyl-3-methyl-6,7-dihydro-5H-1,4-oxazepine |
| SMILES | CC1=COCCCN1Cc1ccccc1 |
| InChI | InChI=1S/C13H17NO/c1-12-11-15-9-5-8-14(12)10-13-6-3-2-4-7-13/h2-4,6-7,11H,5,8-10H2,1H3 |
| InChIKey | OQIKXCJRKAPLNF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |