C22H17F2NO — CID 11602714
2-benzyl-5-(2,5-difluorophenyl)-3-phenyl-3H-1,2-oxazole (PubChem CID 11602714) has the molecular formula C22H17F2NO and a molecular weight of 349.38 g/mol. Its IUPAC name is 2-benzyl-5-(2,5-difluorophenyl)-3-phenyl-3H-1,2-oxazole.
| Compound Name | 2-benzyl-5-(2,5-difluorophenyl)-3-phenyl-3H-1,2-oxazole |
|---|---|
| PubChem CID | 11602714 |
| Molecular Formula | C22H17F2NO |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-benzyl-5-(2,5-difluorophenyl)-3-phenyl-3H-1,2-oxazole |
| SMILES | Fc1ccc(F)c(C2=CC(c3ccccc3)N(Cc3ccccc3)O2)c1 |
| InChI | InChI=1S/C22H17F2NO/c23-18-11-12-20(24)19(13-18)22-14-21(17-9-5-2-6-10-17)25(26-22)15-16-7-3-1-4-8-16/h1-14,21H,15H2 |
| InChIKey | MKOPUALEZXEOQY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |