C16H14FNO — CID 10901219
5-(4-fluorophenyl)-2-methyl-4-phenyl-3H-1,2-oxazole (PubChem CID 10901219) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methyl-4-phenyl-3H-1,2-oxazole.
| Compound Name | 5-(4-fluorophenyl)-2-methyl-4-phenyl-3H-1,2-oxazole |
|---|---|
| PubChem CID | 10901219 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methyl-4-phenyl-3H-1,2-oxazole |
| SMILES | CN1CC(c2ccccc2)=C(c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C16H14FNO/c1-18-11-15(12-5-3-2-4-6-12)16(19-18)13-7-9-14(17)10-8-13/h2-10H,11H2,1H3 |
| InChIKey | YMXUABAWYDXQKS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|