C17H16FNOS — CID 10924616
4-(4-fluorophenyl)-2-methyl-5-(4-methylsulfanylphenyl)-3H-1,2-oxazole (PubChem CID 10924616) has the molecular formula C17H16FNOS and a molecular weight of 301.39 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2-methyl-5-(4-methylsulfanylphenyl)-3H-1,2-oxazole.
| Compound Name | 4-(4-fluorophenyl)-2-methyl-5-(4-methylsulfanylphenyl)-3H-1,2-oxazole |
|---|---|
| PubChem CID | 10924616 |
| Molecular Formula | C17H16FNOS |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-(4-fluorophenyl)-2-methyl-5-(4-methylsulfanylphenyl)-3H-1,2-oxazole |
| SMILES | CSc1ccc(C2=C(c3ccc(F)cc3)CN(C)O2)cc1 |
| InChI | InChI=1S/C17H16FNOS/c1-19-11-16(12-3-7-14(18)8-4-12)17(20-19)13-5-9-15(21-2)10-6-13/h3-10H,11H2,1-2H3 |
| InChIKey | KREAMEYGISLUJJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|