C21H21F2NO — CID 11638697
2-cyclohexyl-5-(2,5-difluorophenyl)-3-phenyl-3H-1,2-oxazole (PubChem CID 11638697) has the molecular formula C21H21F2NO and a molecular weight of 341.40 g/mol. Its IUPAC name is 2-cyclohexyl-5-(2,5-difluorophenyl)-3-phenyl-3H-1,2-oxazole.
| Compound Name | 2-cyclohexyl-5-(2,5-difluorophenyl)-3-phenyl-3H-1,2-oxazole |
|---|---|
| PubChem CID | 11638697 |
| Molecular Formula | C21H21F2NO |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-cyclohexyl-5-(2,5-difluorophenyl)-3-phenyl-3H-1,2-oxazole |
| SMILES | Fc1ccc(F)c(C2=CC(c3ccccc3)N(C3CCCCC3)O2)c1 |
| InChI | InChI=1S/C21H21F2NO/c22-16-11-12-19(23)18(13-16)21-14-20(15-7-3-1-4-8-15)24(25-21)17-9-5-2-6-10-17/h1,3-4,7-8,11-14,17,20H,2,5-6,9-10H2 |
| InChIKey | OFUULGIQLSQFHH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |