C25H23N5O2S — CID 11612264
2-[(4-ethynylphenyl)carbamoylamino]-N-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 11612264) has the molecular formula C25H23N5O2S and a molecular weight of 457.56 g/mol. Its IUPAC name is 2-[(4-ethynylphenyl)carbamoylamino]-N-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | 2-[(4-ethynylphenyl)carbamoylamino]-N-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 11612264 |
| Molecular Formula | C25H23N5O2S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | 2-[(4-ethynylphenyl)carbamoylamino]-N-[4-(1-methyl-4,5-dihydroimidazol-2-yl)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | C#Cc1ccc(NC(=O)NC(C(=O)Nc2ccc(C3=NCCN3C)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C25H23N5O2S/c1-3-17-6-10-20(11-7-17)28-25(32)29-22(21-5-4-16-33-21)24(31)27-19-12-8-18(9-13-19)23-26-14-15-30(23)2/h1,4-13,16,22H,14-15H2,2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | UAVYTISYUUUKRR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|