C18H15N3O3S — CID 69081151
[(1S)-2-oxo-2-(4-pyridin-4-ylanilino)-1-thiophen-2-ylethyl]carbamic acid (PubChem CID 69081151) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is [(1S)-2-oxo-2-(4-pyridin-4-ylanilino)-1-thiophen-2-ylethyl]carbamic acid.
| Compound Name | [(1S)-2-oxo-2-(4-pyridin-4-ylanilino)-1-thiophen-2-ylethyl]carbamic acid |
|---|---|
| PubChem CID | 69081151 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | [(1S)-2-oxo-2-(4-pyridin-4-ylanilino)-1-thiophen-2-ylethyl]carbamic acid |
| SMILES | O=C(O)N[C@@H](C(=O)Nc1ccc(-c2ccncc2)cc1)c1cccs1 |
| InChI | InChI=1S/C18H15N3O3S/c22-17(16(21-18(23)24)15-2-1-11-25-15)20-14-5-3-12(4-6-14)13-7-9-19-10-8-13/h1-11,16,21H,(H,20,22)(H,23,24)/t16-/m1/s1 |
| InChIKey | JIXACTXKBOYOKD-MRXNPFEDSA-N |
| XLogP | 3.76 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |