C28H31N7O2 — CID 11612977
N-[2-(methylamino)ethyl]-6-(2-methylphenyl)-2-(4-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidine-7-carboxamide (PubChem CID 11612977) has the molecular formula C28H31N7O2 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-6-(2-methylphenyl)-2-(4-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | N-[2-(methylamino)ethyl]-6-(2-methylphenyl)-2-(4-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 11612977 |
| Molecular Formula | C28H31N7O2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | N-[2-(methylamino)ethyl]-6-(2-methylphenyl)-2-(4-morpholin-4-ylanilino)pyrido[2,3-d]pyrimidine-7-carboxamide |
| SMILES | CNCCNC(=O)c1nc2nc(Nc3ccc(N4CCOCC4)cc3)ncc2cc1-c1ccccc1C |
| InChI | InChI=1S/C28H31N7O2/c1-19-5-3-4-6-23(19)24-17-20-18-31-28(34-26(20)33-25(24)27(36)30-12-11-29-2)32-21-7-9-22(10-8-21)35-13-15-37-16-14-35/h3-10,17-18,29H,11-16H2,1-2H3,(H,30,36)(H,31,32,33,34) |
| InChIKey | RUNHXYADSQKEOD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 104.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|