C22H15N5O4S — CID 11619203
2-[3-[(4-cyanophenyl)methyl]-6-nitroindolizin-1-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide (PubChem CID 11619203) has the molecular formula C22H15N5O4S and a molecular weight of 445.46 g/mol. Its IUPAC name is 2-[3-[(4-cyanophenyl)methyl]-6-nitroindolizin-1-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide.
| Compound Name | 2-[3-[(4-cyanophenyl)methyl]-6-nitroindolizin-1-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 11619203 |
| Molecular Formula | C22H15N5O4S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 2-[3-[(4-cyanophenyl)methyl]-6-nitroindolizin-1-yl]-N-(3-methyl-1,2-thiazol-5-yl)-2-oxoacetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2cc(Cc3ccc(C#N)cc3)n3cc([N+](=O)[O-])ccc23)sn1 |
| InChI | InChI=1S/C22H15N5O4S/c1-13-8-20(32-25-13)24-22(29)21(28)18-10-17(9-14-2-4-15(11-23)5-3-14)26-12-16(27(30)31)6-7-19(18)26/h2-8,10,12H,9H2,1H3,(H,24,29) |
| InChIKey | GAAXURHWZCCBKG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|