C15H18N2O — CID 11622862
7-methyl-6-methylidene-8-phenyl-2,5,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-3-one (PubChem CID 11622862) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 7-methyl-6-methylidene-8-phenyl-2,5,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-3-one.
| Compound Name | 7-methyl-6-methylidene-8-phenyl-2,5,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-3-one |
|---|---|
| PubChem CID | 11622862 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 7-methyl-6-methylidene-8-phenyl-2,5,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-3-one |
| SMILES | C=C1CN2C(=O)CCN2C(c2ccccc2)C1C |
| InChI | InChI=1S/C15H18N2O/c1-11-10-17-14(18)8-9-16(17)15(12(11)2)13-6-4-3-5-7-13/h3-7,12,15H,1,8-10H2,2H3 |
| InChIKey | JGBKYHJLSNRPEJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|